S9555148
AC/DCinput240VAC
Synonym(s):
(S)-(−)-2-Trifluoroacetamidosuccinic anhydride;N-Trifluoroacetyl-L -aspartic acid anhydride
| Pack Size | Price | Stock | Quantity |
| 1ea | RMB29214.06 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-132 °C (lit.) |
| Boiling point: | 379.2±42.0 °C(Predicted) |
| Density | 1.60±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 8+-.0.20(Predicted) |
| optical activity | [α]20/D 28.0°, c = 1 in THF |
| InChI | 1S/C6H4F3NO4/c7-6(8,9)5(13)10-2-1-3(11)14-4(2)12/h2H,1H2,(H,10,13)/t2-/m0/s1 |
| InChIKey | ABTJOHYOWBAGTP-REOHCLBHSA-N |
| SMILES | FC(F)(F)C(=O)N[C@H]1CC(=O)OC1=O |
Description and Uses
Useful in the synthesis of 2-amino-6,7-dihydroxy-1,2,3,4-tetrahydronaphthalene, a potent dopamine agonist. Used in the synthesis of sweetening agents, such as N-trifluoroacetyl-L-aspartic acid α-amides and α-anilides.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 36-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |







