S9563248
PESTANAL?,analyticalstandard , 63935-38-6
Synonym(s):
(RS)-α-Cyano-3-phenoxybenzyl (RS)-2,2-dichloro-1-(4-ethoxyphenyl)cyclopropanecarboxylate
CAS NO.:63935-38-6
Empirical Formula: C26H21Cl2NO4
Molecular Weight: 482.36
MDL number: MFCD00210269
EINECS: 200-589-5
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2301.43 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25℃ |
| Boiling point: | 142.5 °C |
| Density | 1.36±0.1 g/cm3(Predicted) |
| vapor pressure | 2.13×10-6 Pa (20 °C) |
| storage temp. | 2-8°C |
| Water Solubility | 0.09 mg l-1(25 °C) |
| BRN | 14340823 |
| InChI | 1S/C26H21Cl2NO4/c1-2-31-20-13-11-19(12-14-20)25(17-26(25,27)28)24(30)33-23(16-29)18-7-6-10-22(15-18)32-21-8-4-3-5-9-21/h3-15,23H,2,17H2,1H3 |
| InChIKey | CGTWCAVZZBLHQH-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(cc1)C2(CC2(Cl)Cl)C(=O)OC(C#N)c3cccc(Oc4ccccc4)c3 |
Description and Uses
Cycloprothrin is used to control rice water weevils and other insects in paddy rice, fruit, vegetables, tea, cotton, soyabeans and in forestry.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |








