S960979
powder,≥98%(TLC) , 75847-73-3
Synonym(s):
(S)-(−)-1-[N-(1-Ethoxycarbonyl-3-phenylpropyl)-L -alanyl]-L proline
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB524.64 | In Stock |
|
| 1g | RMB1496.72 | In Stock |
|
| 5g | RMB5171.07 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-147℃ |
| Boiling point: | 582.4±50.0 °C(Predicted) |
| Density | 1.204±0.06 g/cm3(Predicted) |
| RTECS | TW3665500 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in DMSO |
| form | Powder |
| pka | pKa 2.97 (H2O t=25.0)(Approximate);5.35(H2O t=25.0)(Approximate) |
| color | White to off-white |
| optical activity | -58.8066°(C=0.7659g/100ml DMF) |
| Water Solubility | Soluble in water at 25mg/ml |
| BCS Class | 3 |
| InChIKey | GBXSMTUPTTWBMN-XIRDDKMYSA-N |
| SMILES | C(O)(=O)[C@@H]1CCCN1C(=O)[C@H](C)N[C@H](C(OCC)=O)CCC1=CC=CC=C1 |
| CAS DataBase Reference | 75847-73-3(CAS DataBase Reference) |
| EPA Substance Registry System | L-Proline, N-[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]-L-alanyl- (75847-73-3) |
Description and Uses
It is used for hypertension and chronic cardiac insufficiency.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H317-H361 |
| Precautionary statements | P280 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Hazardous Substances Data | 75847-73-3(Hazardous Substances Data) |
