S9681548
forsynthesis , 4261-68-1
Synonym(s):
2-(Diisopropylamino)-ethylchloride hydrochloride;N-(2-Chloroethyl)-diisopropylamine hydrochloride
CAS NO.:4261-68-1
Empirical Formula: C8H19Cl2N
Molecular Weight: 200.15
MDL number: MFCD00012496
EINECS: 224-238-1
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-132 °C(lit.) |
| storage temp. | Store below +30°C. |
| solubility | H2O: 0.1 g/mL, clear |
| form | crystals |
| PH | 4.0-4.5 (10g/l, H2O, 20℃) |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| BRN | 3551603 |
| InChI | 1S/C8H18ClN.ClH/c1-7(2)10(6-5-9)8(3)4;/h7-8H,5-6H2,1-4H3;1H |
| InChIKey | IUSXYVRFJVAVOB-UHFFFAOYSA-N |
| SMILES | [Cl-].ClCCN(C(C)C)C(C)C.[H+] |
| CAS DataBase Reference | 4261-68-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanamine, N-(2-chloroethyl)-N-(1-methylethyl)-, hydrochloride (4261-68-1) |
Description and Uses
Organic synthesis especially for introduction of the β-diisopropylaminoethyl radical.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H310+H330-H314 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T,C,T+ |
| Risk Statements | 23/24/25-34-36/37/38-26-24/25 |
| Safety Statements | 26-36/37/39-45-38-28A-28 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | TX1521900 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29211980 |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |
| Toxicity | LD50 orally in Rabbit: 96.75 mg/kg LD50 dermal Rabbit 197 mg/kg |





