S993378
Titanium(IV) butoxide, polymer , 9022-96-2
Synonym(s):
Tetrabutyl titanate polymer;Tilcom PBT;Titanium tetrabutoxide polymer;Tytan PBT;Tyzor BTP
| Pack Size | Price | Stock | Quantity |
| 250ml | RMB658.58 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −39 °C(lit.) |
| Boiling point: | 3200-3500°C |
| Density | 1.13 g/mL at 25 °C(lit.) |
| vapor pressure | <0.8 mm Hg ( 20 °C) |
| Flash point: | 90 °F |
| InChI | 1S/4C4H9O.Ti/c4*1-2-3-4-5;/h4*2-4H2,1H3;/q4*-1;+4 |
| InChIKey | YHWCPXVTRSHPNY-UHFFFAOYSA-N |
| SMILES | CCCCO[Ti](OCCCC)(OCCCC)OCCCC |
| EPA Substance Registry System | 1-Butanol, titanium(4+) salt, homopolymer (9022-96-2) |
Description and Uses
Poly(titanium butoxide) is a polymer, mostly used as a chemical material, which can be used to study the thermal properties of siloxane-coated KT-30 produced by different methods.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H318 |
| Precautionary statements | P210-P233-P240-P241-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 10-22-37/38-41-67 |
| Safety Statements | 16-26-36/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 |
