T0005431
2,4,4,6-Tetrabromo-2,5-cyclohexadienone , >97.0%(T) , 20244-61-5
Synonym(s):
TBCO
CAS NO.:20244-61-5
Empirical Formula: C6H2Br4O
Molecular Weight: 409.7
MDL number: MFCD00001589
EINECS: 243-638-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB348.00 | In Stock |
|
| 25g | RMB1356.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-127 °C |
| Boiling point: | 365.8±42.0 °C(Predicted) |
| Density | 2.6462 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C |
| solubility | sol CH2Cl2, Et2O, CHCl3, MeNO2, MeOH |
| form | Liquid |
| color | Clear colorless |
| Water Solubility | Insoluble in water. |
| BRN | 2048028 |
| InChI | 1S/C6H2Br4O/c7-3-1-6(9,10)2-4(8)5(3)11/h1-2H |
| InChIKey | NJQJGRGGIUNVAB-UHFFFAOYSA-N |
| SMILES | BrC1=CC(Br)(Br)C=C(Br)C1=O |
| CAS DataBase Reference | 20244-61-5(CAS DataBase Reference) |
Description and Uses
2,4,4,6-Tetrabromo-2,5-cyclohexadienone was used as catalyst for efficient deoxygenation of sulfoxides to their corresponding sulfides with 1,3-dithiane. It was also used as reagent for conversion of alcohols to azides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







