PRODUCT Properties
| Melting point: | -48 °C |
| Boiling point: | 83 °C(lit.) |
| Density | 1.393 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 40 °F |
| storage temp. | Refrigerator |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 743.1mg/L(25 ºC) |
| InChI | InChI=1S/C6H2F4/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| InChIKey | UHHYOKRQTQBKSB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=CC(F)=C1F |
| CAS DataBase Reference | 2367-82-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2,3,5-tetrafluoro-(2367-82-0) |
Description and Uses
Intermediates of pharmaceuticals, pesticides, and liquid crystal materials.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H318-H411 |
| Precautionary statements | P210-P273-P280-P305+P351+P338+P310 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-7-33-29-7/9 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29039990 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
