PRODUCT Properties
| Melting point: | 30-31°C |
| Boiling point: | 141°C 1mm |
| Density | 1,02 g/cm3 |
| refractive index | 1.495 |
| Flash point: | 77°C |
| solubility | soluble in Toluene |
| color | White or Colorless to Almost white or Almost colorless |
| Specific Gravity | 1.02 |
| Water Solubility | Reacts with water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/4C4H9O.Ti/c4*1-4(2)3-5;/h4*4H,3H2,1-2H3;/q4*-1;+4 |
| InChIKey | QUVMSYUGOKEMPX-UHFFFAOYSA-N |
| SMILES | [Ti](OCC(C)C)(OCC(C)C)(OCC(C)C)OCC(C)C |
| LogP | 2.95 at 20℃ |
| CAS DataBase Reference | 7425-80-1 |
| EPA Substance Registry System | 1-Propanol, 2-methyl-, titanium(4+) salt (7425-80-1) |
Description and Uses
Titanium(IV) isobutoxide general application in chemical research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| TSCA | TSCA listed |
| HS Code | 2905.19.9090 |
| HazardClass | 3 |
| PackingGroup | III |







