T0143031
(R,R)-Ts-DENEB? , 1333981-84-2
CAS NO.:1333981-84-2
Empirical Formula: C31H28ClN2O3RuS
Molecular Weight: 645.16
MDL number: MFCD20922902
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB520.00 | In Stock |
|
| 1g | RMB1796.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | solid |
| color | gray to brown |
| Sensitive | air sensitive |
| InChIKey | INKUCOHLIHBSDN-ZAMYOOMVSA-M |
| SMILES | [Ru+2].[S](=O)(=O)([N-][C@@H]([C@H](NCCOCc4ccc(cc4)C)c3ccccc3)c2ccccc2)c1ccc(cc1)C.[Cl-] |
Description and Uses
(R,R)-Ts-DENEB (CAS# 1333981-84-2) is a catalyst used in asymmetric hydrogen transfer reactions, such as in the synthesis of 2-(1,2,3,4-tetrahydro-1-isoquinolyl)ethanol derivatives. (R,R)-Ts-DENEB is used to form hydrogen carrier systems, where the catalytic dehydrogenative coupling of methanol and 1,2-diamine is used to generate H2 without the production of CO2.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H373-H351-H411 |
| Precautionary statements | P501-P273-P260-P202-P201-P280-P391-P308+P313-P405 |
| RIDADR | UN 3077 9/PG III |
| WGK Germany | WGK 3 |
| HS Code | 2843.90.0000 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |




![(S)-5,5'-Bis[di(3,5-di-tert-butyl-4-methoxyphenyl)phosphino]-4,4'-bi-1,3-benzodioxole](https://img.chemicalbook.com/CAS/GIF/210169-40-7.gif)

![Chloro{(R)-(+)-2,2'-bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl}[(2R)-(-)-1-(4-methoxyphenyl)-1-(4-methoxyphenyl-kC)-3-methyl-1,2-butanediamine]ruthenium(II)](https://img.chemicalbook.com/CAS/20211123/GIF/1384974-38-2.gif)
