T0166231
α,α,α',α'-Tetramethyl-1,3-benzenedipropionic Acid , >98.0%(GC)(T) , 819050-88-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1576.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-136 °C |
| Boiling point: | 437.0±25.0 °C(Predicted) |
| Density | 1.143±0.06 g/cm3(Predicted) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.45±0.13(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C16H22O4/c1-15(2,13(17)18)9-11-6-5-7-12(8-11)10-16(3,4)14(19)20/h5-8H,9-10H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | BZWQVGTVYGEXTE-UHFFFAOYSA-N |
| SMILES | CC(C)(Cc1cccc(CC(C)(C)C(O)=O)c1)C(O)=O |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2915.50.2000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |