T3397731
1,6-Bis(trichlorosilyl)hexane , >95.0%(GC) , 13083-94-8
Synonym(s):
1,6-Bis(trichlorosilyl)hexane
CAS NO.:13083-94-8
Empirical Formula: C6H12Cl6Si2
Molecular Weight: 353.05
MDL number: MFCD00053189
EINECS: 235-994-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB392.00 | In Stock |
|
| 25g | RMB1512.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25°C |
| Boiling point: | 281 °C(lit.) |
| Density | 1.327 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 167 °F |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.327 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1768655 |
| InChI | 1S/C6H12Cl6Si2/c7-13(8,9)5-3-1-2-4-6-14(10,11)12/h1-6H2 |
| InChIKey | ICJGKYTXBRDUMV-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CCCCCC[Si](Cl)(Cl)Cl |
| EPA Substance Registry System | Silane, 1,6-hexanediylbis[trichloro- (13083-94-8) |
Description and Uses
1,6-Bis(trichlorosilyl)hexane is a silane based cross-linking agent that can be used in the synthesis of polymeric blended films. These films are majorly utilized as dielectrics for applications in organic electronic based devices such as organic field effect transistors (OFETs) and organic thin film transistors (OTFTs).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-43-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







