T3405231
Trihexyl O-Butyrylcitrate , >92.0%(GC) , 82469-79-2
| Pack Size | Price | Stock | Quantity |
| 25g | RMB232.00 | In Stock |
|
| 500g | RMB792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −55 °C(lit.) |
| Boiling point: | 520.24°C (rough estimate) |
| Density | 0.993 |
| vapor density | 17.7 (vs air) |
| vapor pressure | 0Pa at 20-25℃ |
| refractive index | n20/D 1.448(lit.) |
| Flash point: | 113 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Colorless to Light yellow |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT PLASTICISER |
| InChI | 1S/C28H50O8/c1-5-9-12-15-19-33-25(30)22-28(36-24(29)18-8-4,27(32)35-21-17-14-11-7-3)23-26(31)34-20-16-13-10-6-2/h5-23H2,1-4H3 |
| InChIKey | GWVUTNGDMGTPFE-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)CC(CC(=O)OCCCCCC)(OC(=O)CCC)C(=O)OCCCCCC |
| LogP | 4 at 21℃ and pH5.7 |
| EPA Substance Registry System | 1,2,3-Propanetricarboxylic acid, 2-(1-oxobutoxy)-, trihexyl ester (82469-79-2) |
Description and Uses
Trihexyl O-Butyrylcitrate is a non-toxic plasticizer, widely used in non-toxic PVC granulation, medical products, soft children's toys, ink coatings, etc.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 2918.15.5000 |
| Storage Class | 10 - Combustible liquids |
