PRODUCT Properties
| Melting point: | 234-238 °C(lit.) |
| Boiling point: | 427.9±47.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | Crystalline Powder |
| pka | 11.10±0.10(Predicted) |
| color | White |
| BRN | 173013 |
| InChI | 1S/C13H9ClN2/c14-10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)16-13/h1-8H,(H,15,16) |
| InChIKey | OILIYWFQRJOPAI-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1-c2nc3ccccc3[nH]2 |
| CAS DataBase Reference | 3574-96-7(CAS DataBase Reference) |
Description and Uses
Chlorfenazole, also known as 2-(2-Chlorophenyl)-1H-benzimidazole, is a biologically active compound that is commonly used in agriculture. It belongs to the benzimidazole derivative family and has the potential to display anti-parasitic, anti-fungal, or anti-inflammatory properties.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 37/39 |
| WGK Germany | 3 |
| RTECS | DD6963500 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |







