PRODUCT Properties
| Melting point: | -70 °C |
| Boiling point: | 35 °C |
| Density | 1,53 g/cm3 |
| Flash point: | -20°C |
| Water Solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C5F10O/c6-1(7)2(8)16-5(14,15)3(9,10)4(11,12)13 |
| InChIKey | KHXKESCWFMPTFT-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(F)(F)C(F)(F)O/C(/F)=C(/F)\F |
| CAS DataBase Reference | 1623-05-8(CAS DataBase Reference) |
| EPA Substance Registry System | Propane, 1,1,1,2,2,3,3-heptafluoro-3-[(trifluoroethenyl)oxy]- (1623-05-8) |
Description and Uses
Heptafluoropropyl trifluorovinyl ether is an important fluorine-containing synthetic intermediate and a key raw material for the synthesis of fusible polytetrafluoroethylene.







