T7580530
4-Amino-2,6-diphenylphenol , >98.0%(T) , 50432-01-4
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB360.00 | In Stock |
|
| 1g | RMB632.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C (lit.) |
| Boiling point: | 463.5±45.0 °C(Predicted) |
| Density | 1.183±0.06 g/cm3(Predicted) |
| pka | 10.29±0.23(Predicted) |
| form | powder to crystal |
| color | White to Brown to Dark purple |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C18H15NO/c19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14/h1-12,20H,19H2 |
| InChIKey | YCOUFOVMXBWYIX-UHFFFAOYSA-N |
| SMILES | Nc1cc(c(O)c(c1)-c2ccccc2)-c3ccccc3 |
| CAS DataBase Reference | 50432-01-4(CAS DataBase Reference) |
Description and Uses
4-Amino-2,6-diphenylphenol was used in the synthesis of 4-diazo-2,6-diphenylcyclohexa-2,5-dienone by undergoing diazotization in glacial acetic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2922.21.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
