T7647830
2-Amino-4-chloro-6-nitrophenol , >98.0%(GC)(T) , 6358-08-3
CAS NO.:6358-08-3
Empirical Formula: C6H5ClN2O3
Molecular Weight: 188.57
MDL number: MFCD00035925
EINECS: 228-761-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB632.00 | In Stock |
|
| 100g | RMB1432.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-162 °C (lit.) |
| Boiling point: | 308.3±42.0 °C(Predicted) |
| Density | 1.655±0.06 g/cm3(Predicted) |
| solubility | soluble in Acetone |
| form | Powder |
| pka | 6.06±0.38(Predicted) |
| color | Dark red to brown |
| InChI | 1S/C6H5ClN2O3/c7-3-1-4(8)6(10)5(2-3)9(11)12/h1-2,10H,8H2 |
| InChIKey | MHAFRUMLQZZSIN-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc(c1O)[N+]([O-])=O |
| CAS DataBase Reference | 6358-08-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Amino-4-chloro-6-nitrophenol (6358-08-3) |
Description and Uses
Intermediate in the preparation of antipsychotics
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 6.1 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





