T7706830
5-Amino-3,4-dimethylisoxazole , >98.0%(GC)(T) , 19947-75-2
CAS NO.:19947-75-2
Empirical Formula: C5H8N2O
Molecular Weight: 112.13
MDL number: MFCD00046081
EINECS: 243-437-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB556.00 | In Stock |
|
| 25g | RMB2256.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-122 °C(lit.) |
| Boiling point: | 246.0±35.0 °C(Predicted) |
| Density | 1.118±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO, Methanol |
| pka | -0.24±0.50(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 108546 |
| InChI | InChI=1S/C5H8N2O/c1-3-4(2)7-8-5(3)6/h6H2,1-2H3 |
| InChIKey | PYNDWPFZDQONDV-UHFFFAOYSA-N |
| SMILES | O1C(N)=C(C)C(C)=N1 |
| CAS DataBase Reference | 19947-75-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Amino-3,4-dimethyl-isoxazole(19947-75-2) |
Description and Uses
5-amino-3,4-dimethylisoxazole formed complexes with cobalt(II) and copper(II). The kinetics of gas-phase thermal isomerization of 5-amino-3,4-dimethylisoxazole was studied.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



