T7801730
(-)-cis-2-Benzylaminocyclohexanemethanol , >98.0%(T) , 71581-93-6
Synonym(s):
(1S,2R)-(−)-cis-[2-(Benzylamino)cyclohexyl]methanol;(1S,2R)-cis-2-(Benzylamino)cyclohexanemethanol
CAS NO.：71581-93-6
Empirical Formula: C14H21NO
Molecular Weight: 219.32
MDL number: MFCD00151396
EINECS: 623-138-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB596.00 | In Stock |
|
| 5g | RMB2624.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-69 °C(lit.) |
| Boiling point: | 352.8±15.0 °C(Predicted) |
| Density | 1.04±0.1 g/cm3(Predicted) |
| refractive index | -24 ° (C=1, MeOH) |
| storage temp. | 2-8°C, protect from light |
| form | powder to crystal |
| pka | 15.05±0.10(Predicted) |
| color | White to Light yellow |
| optical activity | [α]20/D 24°, c = 1 in methanol |
| BRN | 8393598 |
| InChI | 1S/C14H21NO/c16-11-13-8-4-5-9-14(13)15-10-12-6-2-1-3-7-12/h1-3,6-7,13-16H,4-5,8-11H2/t13-,14-/m1/s1 |
| InChIKey | BRQFIORUNWWNBM-ZIAGYGMSSA-N |
| SMILES | OC[C@H]1CCCC[C@H]1NCc2ccccc2 |
| CAS DataBase Reference | 71581-93-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922.19.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
