T7990930
2-tert-Butylanthracene , >98.0%(GC) , 18801-00-8
CAS NO.：18801-00-8
Empirical Formula: C18H18
Molecular Weight: 234.34
MDL number: MFCD00003581
EINECS: 242-588-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB752.00 | In Stock |
|
| 5g | RMB2232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148 °C(lit.) |
| Boiling point: | 406.66°C (estimate) |
| Density | 1.0157 (estimate) |
| refractive index | 1.6855 (estimate) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C18H18/c1-18(2,3)17-9-8-15-10-13-6-4-5-7-14(13)11-16(15)12-17/h4-12H,1-3H3 |
| InChIKey | WBPXZSIKOVBSAS-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2)C=CC=C3)=CC=C1C(C)(C)C |
| CAS DataBase Reference | 18801-00-8 |
| EPA Substance Registry System | 2-tert-Butylanthracene (18801-00-8) |
Safety
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29029000 |
