T8166030
Isopropyl Chloroformate , >97.0%(GC)(T) , 108-23-6
CAS NO.：108-23-6
Empirical Formula: C4H7ClO2
Molecular Weight: 122.55
MDL number: MFCD00075068
EINECS: 203-563-2
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 105 °C |
| Density | 0.892 g/mL at 25 °C |
| vapor pressure | 27.998hPa at 20℃ |
| refractive index | n |
| Flash point: | 43 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Dichloromethane (Soluble), Ethyl Acetate (Slightly), Tol |
| form | liquid |
| BRN | 506416 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C4H7ClO2/c1-3(2)7-4(5)6/h3H,1-2H3 |
| InChIKey | IVRIRQXJSNCSPQ-UHFFFAOYSA-N |
| SMILES | C(Cl)(OC(C)C)=O |
| CAS DataBase Reference | 108-23-6(CAS DataBase Reference) |
| EPA Substance Registry System | Isopropyl chloroformate (108-23-6) |
Description and Uses
Chemical intermediate for free-radical polymerization initiators, organic synthesis.
Safety
| Symbol(GHS) |     GHS02,GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304-H314-H317-H330-H336-H361d-H373 |
| Precautionary statements | P210-P260-P280-P284-P301+P310-P305+P351+P338 |
| Hazard Codes | F,C,T+ |
| Risk Statements | 11-34-48/20-63-65-67-43-26 |
| Safety Statements | 26-36/37/39-45-62-28-16 |
| RIDADR | UN 3286 3/PG 2 |
| WGK Germany | 2 |
| RTECS | LQ6475000 |
| F | 10-19 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29159000 |
| Hazardous Substances Data | 108-23-6(Hazardous Substances Data) |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
