T8379230
Coumarin 343 , 55804-65-4
CAS NO.：55804-65-4
Empirical Formula: C16H15NO4
Molecular Weight: 285.29
MDL number: MFCD00051335
EINECS: 259-824-6
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB1124.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240 °C(lit.) |
| Boiling point: | 574.8±50.0 °C(Predicted) |
| Density | 1.47±0.1 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | Chloroform: Slightly soluble: 0.1-1 mg/ml DMSO: Slightly soluble: 0.1-1 mg/ml |
| pka | -98.22±0.20(Predicted) |
| form | Crystalline Powder |
| color | Orange |
| λmax | 443 nm |
| ε(extinction coefficient) | ≥26000 at 441-445nm in ethanol at 0.01g/L |
| InChI | InChI=1S/C16H15NO4/c18-15(19)12-8-10-7-9-3-1-5-17-6-2-4-11(13(9)17)14(10)21-16(12)20/h7-8H,1-6H2,(H,18,19) |
| InChIKey | KCDCNGXPPGQERR-UHFFFAOYSA-N |
| SMILES | C12=C3OC(=O)C(C(O)=O)=CC3=CC3=C1N(CCC3)CCC2 |
| EPA Substance Registry System | 1H,5H,11H-[1]Benzopyrano[6,7,8-ij]quinolizine-10-carboxylic acid, 2,3,6,7-tetrahydro-11-oxo- (55804-65-4) |
Description and Uses
Coumarin 519 is a synthetic fluorescent dye widely used in biomedical research. It serves as a valuable tool for studying drug distribution and pharmacokinetics, as well as for monitoring membrane potential and calcium signaling in live cells. Additionally, it finds applications in fluorescence microscopy, flow cytometry, and bioimaging techniques.
Suitable as a laser dye.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
