T8434930
meso-1,2-Dibromo-1,2-diphenylethane , >97.0%(T) , 13440-24-9
Synonym(s):
Stilbene dibromide
CAS NO.:13440-24-9
Empirical Formula: C14H12Br2
Molecular Weight: 340.05
MDL number: MFCD00000137
EINECS: 635-052-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB520.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241 °C (dec.)(lit.) |
| Boiling point: | 323.8±37.0 °C(Predicted) |
| Density | 1.613±0.06 g/cm3(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 2050820 |
| InChI | 1S/C14H12Br2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+ |
| InChIKey | GKESIQQTGWVOLH-OKILXGFUSA-N |
| SMILES | Br[C@H]([C@H](Br)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 13440-24-9(CAS DataBase Reference) |
Description and Uses
meso-1,2-Dibromo-1,2-diphenylethane is used to study the reaction of ± and meso-SBr2 with 9-substituted fluorenide ions in dimethyl sulfoxide. It undergoes electrochemical dehalogenation in acetonitrile.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 2903.99.8001 |
| HazardClass | 8 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |







