PRODUCT Properties
| Melting point: | -53.15°C |
| Boiling point: | 158°C |
| Density | 0,73 g/cm3 |
| refractive index | 1.3990-1.4130 |
| Flash point: | 34°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 89.16ug/L(temperature not stated) |
| InChI | InChI=1S/C10H22/c1-5-10(4)8-6-7-9(2)3/h9-10H,5-8H2,1-4H3 |
| InChIKey | ZALHPSXXQIPKTQ-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CC |
| LogP | 5.490 (est) |
| CAS DataBase Reference | 2051-30-1(CAS DataBase Reference) |
| EPA Substance Registry System | Octane, 2,6-dimethyl- (2051-30-1) |
Description and Uses
2,6-Dimethyloctane is used as a diesel fuel additive and as a chemical reaction reagent or product. Optically active 6-chloro-2,6-dimethyloctane is capable of being reduced to 2,6-dimethyloctane in alkali metal solutions in liquid ammonia, and its primary configuration remains unchanged[1-2].
Safety
| Symbol(GHS) |   GHS02,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H304 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P301+P310+P331-P303+P361+P353-P370+P378-P403+P235-P405-P501 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | 3295 |
| HS Code | 2901.10.5000 |
| HazardClass | 3 |
| PackingGroup | III |
