T8519530
N,N-Dimethylformamide Dipropyl Acetal [for Esterification] , >90.0%(T) , 6006-65-1
Synonym(s):
1,1-Dipropoxy-N,N-dimethylmethylamine;1,1-Dipropoxytrimethylamine
CAS NO.:6006-65-1
Empirical Formula: C9H21NO2
Molecular Weight: 175.27
MDL number: MFCD00009374
EINECS: 227-855-4
| Pack Size | Price | Stock | Quantity |
| 5mL | RMB152.00 | In Stock |
|
| 25mL | RMB552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 67-68 °C/14 mmHg (lit.) |
| Density | 0.854 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 100 °F |
| storage temp. | Flammables area |
| pka | 5.25±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | It hydrolyzes with water. |
| Sensitive | Moisture Sensitive |
| BRN | 1098524 |
| InChI | InChI=1S/C9H21NO2/c1-5-7-11-9(10(3)4)12-8-6-2/h9H,5-8H2,1-4H3 |
| InChIKey | NSLGQFIDCADTAS-UHFFFAOYSA-N |
| SMILES | C(OCCC)(OCCC)N(C)C |
| CAS DataBase Reference | 6006-65-1(CAS DataBase Reference) |
| NIST Chemistry Reference | N,N-Dimethylformamide dipropyl acetal(6006-65-1) |
Description and Uses
It was used as derivatizing agent in a study to determine cocaine and benzoyl ecgonine in urine using GC with on-column alkylation.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29225000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |

![N,N-Dimethylformamide Dipropyl Acetal [for Esterification]](https://img.chemicalbook.com/CAS/GIF/6006-65-1.gif)




