T8547630
4-(Dimethylamino)azobenzene 4'-Isothiocyanate , >98.0%(HPLC) , 7612-98-8
Synonym(s):
4-(Dimethylamino)azobenzene-4′-isothiocyanate;DABITC
CAS NO.：7612-98-8
Empirical Formula: C15H14N4S
Molecular Weight: 282.36
MDL number: MFCD00004812
EINECS: 231-521-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-171 °C(lit.) |
| Boiling point: | 466.2±30.0 °C(Predicted) |
| Density | 1.2493 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | room temp |
| solubility | dioxane: 20 mg/mL, clear, red |
| pka | 3.28±0.10(Predicted) |
| form | powder to crystal |
| color | Orange to Brown |
| Sensitive | Moisture Sensitive |
| BRN | 752568 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C15H14N4S/c1-19(2)15-9-7-14(8-10-15)18-17-13-5-3-12(4-6-13)16-11-20/h3-10H,1-2H3/b18-17+ |
| InChIKey | OSWZKAVBSQAVFI-ISLYRVAYSA-N |
| SMILES | CN(C)c1ccc(cc1)\N=N\c2ccc(cc2)N=C=S |
| CAS DataBase Reference | 7612-98-8(CAS DataBase Reference) |
Description and Uses
4-(4-Isothiocyanatophenylazo)-N,N-dimethylaniline is a stain/dye. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P280-P342+P311 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 42 |
| Safety Statements | 22-24/25 |
| RIDADR | 3234 |
| WGK Germany | 3 |
| RTECS | NX9125000 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
