T8591730
1,6-Diaminopyrene , >98.0%(N) , 14923-84-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB2784.00 | In Stock |
|
| 500mg | RMB7468.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C |
| Boiling point: | 509.6±30.0 °C(Predicted) |
| Density | 1.394±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 4.82±0.30(Predicted) |
| color | Yellow to Dark Green |
| InChI | InChI=1S/C16H12N2/c17-13-8-4-10-2-6-12-14(18)7-3-9-1-5-11(13)16(10)15(9)12/h1-8H,17-18H2 |
| InChIKey | OWJJRQSAIMYXQJ-UHFFFAOYSA-N |
| SMILES | C1(N)=C2C3=C4C(C=C2)=CC=C(N)C4=CC=C3C=C1 |
Description and Uses
1,6-Pyrenediamine is an intermediate in the synthesis of 1,8-Dinitropyrene (D480270), one of the major mutagens found in contaminated sediments. 1,8-Dinitropyrene is a potential human carcinogen. 1,6-Pyrenediamine may be a possible carcinogen and mutagen.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 |
| RTECS | UR2451000 |
| HS Code | 2921.59.8090 |
