T8605930
Didecylmethylamine , >95.0%(GC) , 7396-58-9
Synonym(s):
DAMA-10;Didecylmethylamine
CAS NO.：7396-58-9
Empirical Formula: C21H45N
Molecular Weight: 311.59
MDL number: MFCD00077727
EINECS: 230-990-1
| Pack Size | Price | Stock | Quantity |
| 25mL | RMB116.00 | In Stock |
|
| 500mL | RMB628.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -7.4 °C |
| Boiling point: | 145 °C / 2mmHg |
| Density | 0.807 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 93°C |
| pka | 9.83±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 1.2μg/L |
| BRN | 1765810 |
| InChI | InChI=1S/C21H45N/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2/h4-21H2,1-3H3 |
| InChIKey | ATBNMWWDBWBAHM-UHFFFAOYSA-N |
| SMILES | C(N(CCCCCCCCCC)C)CCCCCCCCC |
| LogP | 8.8 |
| CAS DataBase Reference | 7396-58-9 |
| EPA Substance Registry System | Didecylmethylamine (7396-58-9) |
Description and Uses
N-?Methyldidecylamine is a reagent used in the synthesis of novel anthraquinone compounds which act as potential anticancer compounds.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H227-H314 |
| Precautionary statements | P210-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P370+P378-P403+P235-P405-P501 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 2 |
| F | 9-34 |
| HS Code | 2921.19.6190 |
| HazardClass | 8 |
| PackingGroup | II |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
