PRODUCT Properties
| Boiling point: | 120 °C |
| Density | 1,5 g/cm3 |
| refractive index | 1.3475 |
| Flash point: | 120°C/15mm |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 1916112 |
| InChI | InChI=1S/C8H6F8O4/c1-19-3(17)5(9,10)7(13,14)8(15,16)6(11,12)4(18)20-2/h1-2H3 |
| InChIKey | XPXVIIILXUOEQA-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(OC)=O |
| CAS DataBase Reference | 3107-98-0(CAS DataBase Reference) |
Description and Uses
Dimethyl Octafluoroadipate can be useful in characterization of aerogels with hybrid organo-inorganic 3D network structure based on polyfluorinated diacids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2917198090 |
