T8765730
3,3'-Diethyloxadicarbocyanine Iodide , >98.0%(N) , 14806-50-9
Synonym(s):
3-Ethyl-2-[5-(3-ethyl-2-benzoxazolinylidene)-1,3-pentadienyl]benzoxazolium iodide;DODC Iodide
CAS NO.：14806-50-9
Empirical Formula: C23H23IN2O2
Molecular Weight: 486.35
MDL number: MFCD00011953
EINECS: 238-873-7
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB664.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | DMF: soluble |
| form | Crystalline Powder |
| color | Blue to purple |
| Sensitive | Light Sensitive |
| λmax | 582 nm |
| BRN | 3838937 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C23H23N2O2.HI/c1-3-24-18-12-8-10-14-20(18)26-22(24)16-6-5-7-17-23-25(4-2)19-13-9-11-15-21(19)27-23;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CLDZYSUDOQXJOU-UHFFFAOYSA-M |
| SMILES | [I-].CCN1\C(Oc2ccccc12)=C\C=C\C=C\c3oc4ccccc4[n+]3CC |
| EPA Substance Registry System | Benzoxazolium, 3-ethyl-2-[5-(3-ethyl-2(3H)-benzoxazolylidene)-1,3-pentadienyl]-, iodide (14806-50-9) |
Description and Uses
3,3'-Diethyloxadicarbocyanine iodide is a sensitive probe used for staining living presynaptic nerve terminals.
3,3''-Diethyloxadicarbocyanine iodide is a sensitive probe.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 4.13-8-10 |
| TSCA | TSCA listed |
| HS Code | 2934.99.4400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
