T8814630
1-(2,6-Dimethylphenoxy)-2-propanone , >95.0%(GC) , 53012-41-2
CAS NO.：53012-41-2
Empirical Formula: C11H14O2
Molecular Weight: 178.23
MDL number: MFCD00130266
EINECS: 258-292-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB396.00 | In Stock |
|
| 5g | RMB1352.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 113°C/4mmHg(lit.) |
| Density | 1.011±0.06 g/cm3(Predicted) |
| refractive index | 1.5060 to 1.5100 |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless to Orange |
| InChI | InChI=1S/C11H14O2/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6H,7H2,1-3H3 |
| InChIKey | XDJULAUHYAJQBU-UHFFFAOYSA-N |
| SMILES | C(OC1=C(C)C=CC=C1C)C(=O)C |
| LogP | 2.3 at 20℃ |
| CAS DataBase Reference | 53012-41-2 |
Description and Uses
Mexiletine (M340800) metabolite.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 |
| HS Code | 2914.69.9000 |
