PRODUCT Properties
| Melting point: | 114-116 °C (lit.) |
| Boiling point: | 351.4±37.0 °C(Predicted) |
| Density | 1.163±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | DMF: soluble |
| form | Solid |
| color | White to Off-White |
| Odor | at 100.00 %. nutty walnut |
| Odor Type | nutty |
| BRN | 169998 |
| InChI | InChI=1S/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
| InChIKey | NKRISXMDKXBVRJ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(OCC)=CC=C2C(C)=C1 |
| LogP | 2.973 (est) |
| CAS DataBase Reference | 87-05-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Methyl-7-ethoxycoumarin(87-05-8) |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 7-ethoxy-4-methyl- (87-05-8) |
Description and Uses
7-Ethoxy-4-methylcoumarin may be used in the assay of 4-chlormethyl-7-ethoxycoumarin O-deethylase activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29322090 |



