T8902530
Ethyl 1-Ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylate , >98.0%(GC) , 100501-62-0
CAS NO.:100501-62-0
Empirical Formula: C14H12F3NO3
Molecular Weight: 299.25
MDL number: MFCD00276022
EINECS: 405-880-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB336.00 | In Stock |
|
| 25g | RMB1452.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-208 °C |
| Boiling point: | 392.3±42.0 °C(Predicted) |
| Density | 1.363±0.06 g/cm3(Predicted) |
| pka | 0.18±0.70(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C14H12F3NO3/c1-3-18-6-8(14(20)21-4-2)13(19)7-5-9(15)10(16)11(17)12(7)18/h5-6H,3-4H2,1-2H3 |
| InChIKey | LWLLHOVWIFISMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(CC)c2c(F)c(F)c(F)cc2C1=O |
| CAS DataBase Reference | 100501-62-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H412 |
| Precautionary statements | P273-P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43-52/53 |
| Safety Statements | 24-37-61 |
| WGK Germany | 2 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Skin Sens. 1 |
| REACH Registrations | Active |





