T8995130
O-Formyl-D-mandeloyl Chloride , >98.0%(GC)(T) , 29169-64-0
Synonym(s):
(−)-O-Formyl-D -mandeloyl chloride;(R)-(−)-α-(Formyloxy)phenylacetyl chloride
CAS NO.:29169-64-0
Empirical Formula: C9H7ClO3
Molecular Weight: 198.6
MDL number: MFCD00799229
EINECS: 249-478-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB1032.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 221 °C(lit.) |
| Density | 1.290 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| optical activity | [α]23/D 228°, neat |
| BRN | 5404068 |
| InChI | 1S/C9H7ClO3/c10-9(12)8(13-6-11)7-4-2-1-3-5-7/h1-6,8H/t8-/m1/s1 |
| InChIKey | YASBRFHEBZXBJW-SSDOTTSWSA-N |
| SMILES | ClC(=O)[C@H](OC=O)c1ccccc1 |
| CAS DataBase Reference | 29169-64-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetyl chloride, .alpha.-(formyloxy)-, (.alpha.R)- (29169-64-0) |
Description and Uses
(R)-(?)-O-Formylmandeloyl chloride can be used as a chiral resolving agent for the resolution of spirobiindane.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29181990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |




