T9030130
Fluroxypyr 1-Methylheptyl Ester , >98.0%(HPLC)(N) , 81406-37-3
Synonym(s):
1-Methylheptyl (4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy)acetate;Fluroxypyr meptyl
CAS NO.:81406-37-3
Empirical Formula: C15H21Cl2FN2O3
Molecular Weight: 367.24
MDL number: MFCD00144318
EINECS: 279-752-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB472.00 | In Stock |
|
| 25g | RMB948.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59 °C |
| Boiling point: | 431.9±40.0 °C(Predicted) |
| Density | 1.268±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | soluble in Methanol |
| form | Solid |
| pka | -1.55±0.10(Predicted) |
| color | White to Light yellow |
| Merck | 13,4229 |
| Major Application | agriculture environmental |
| InChI | 1S/C15H21Cl2FN2O3/c1-3-4-5-6-7-9(2)23-10(21)8-22-15-12(17)13(19)11(16)14(18)20-15/h9H,3-8H2,1-2H3,(H2,19,20) |
| InChIKey | OLZQTUCTGLHFTQ-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)OC(=O)COc1nc(F)c(Cl)c(N)c1Cl |
| CAS DataBase Reference | 81406-37-3(CAS DataBase Reference) |
| EPA Substance Registry System | Fluroxypyr-meptyl (81406-37-3) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H312-H410 |
| Precautionary statements | P273-P280-P302+P352+P312 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | AF2503000 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 |





