PRODUCT Properties
| Melting point: | 226 °C |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Aqueous Base (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,4730 |
| InChI | InChI=1S/C4H3ClF4O2/c1-11-2(10)3(6,7)4(5,8)9/h1H3 |
| InChIKey | FRMDDIJBLQNNTC-RDYJJYPNSA-N |
| SMILES | Cl.N1([C@@H]2C[C@H](C[C@H]1CC2)OC(=O)C(O)c3ccccc3)C |
| CAS DataBase Reference | 637-21-8 |
Description and Uses
Homatropine hydrochloride is an orally active anticholinergic agent that rapidly dilates pupils and has cycloplegic effects. Homatropine hydrochloride also has antitussive activity. Homatropine hydrochloride can be used in research on eye diseases and coughs[1].
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H331-H301-H311 |
| Precautionary statements | P280-P302+P352-P312-P322-P361-P363-P405-P501-P261-P271-P304+P340-P311-P321-P403+P233-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
| RIDADR | UN 1544 6.1/PG III |
| WGK Germany | WGK 3 |
| HS Code | 2939.79.0000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |







