T9110230
Ishikawa's Reagent [Fluorinating Reagent] , >92.0%(T) , 309-88-6
Synonym(s):
Ishikawa’s Reagent
CAS NO.:309-88-6
Empirical Formula: C7H11F6N
Molecular Weight: 223.16
MDL number: MFCD00054683
EINECS: 628-698-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB600.00 | In Stock |
|
| 100g | RMB1352.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 56-57 °C (lit.) |
| Density | 1.230 g/mL at 25 °C (lit.) |
| refractive index | 1.3460 |
| Flash point: | 56-57°C/58mm |
| storage temp. | Flammables area |
| solubility | soluble in Acetone,Ether |
| pka | 1.50±0.70(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.230 |
| Merck | 14,5108 |
| InChI | 1S/C7H11F6N/c1-3-14(4-2)7(12,13)5(8)6(9,10)11/h5H,3-4H2,1-2H3 |
| InChIKey | BNTFCVMJHBNJAR-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(F)(F)C(F)C(F)(F)F |
| CAS DataBase Reference | 309-88-6(CAS DataBase Reference) |
| EPA Substance Registry System | N,N-Diethyl-2H-perfluoropropanamine (309-88-6) |
Description and Uses
Reactant for:
- Friedel-Crafts type arylation of hydrofluorocarbons
- Microbial hydroxylation of antibiotics
- Electrochemical fluorination of trialkylamines and tetraalkylammonium salts
- Fluorination of pyrethroides
Reactant for synthesis of:
- γ-Hydroxy-α-fluoro-α-trifluoromethylcarboxamide
- Florfenicol and thiamphenicol
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles |
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | 3267 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29211999 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |

![Ishikawa's Reagent [Fluorinating Reagent]](https://img.chemicalbook.com/CAS/GIF/309-88-6.gif)





