T9130230
Heptadecafluorononanoic Acid , >95.0%(GC)(T) , 375-95-1
Synonym(s):
Heptadecafluorononanoic acid;Perfluorononanoic acid
CAS NO.：375-95-1
Empirical Formula: C9HF17O2
Molecular Weight: 464.08
MDL number: MFCD00039605
EINECS: 206-801-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB244.00 | In Stock |
|
| 25g | RMB856.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-62 °C (lit.) |
| Boiling point: | 218°C |
| Density | 1.7397 (estimate) |
| Flash point: | 218°C |
| storage temp. | Refrigerator |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 0.52±0.10(Predicted) |
| form | Solid |
| color | Off-White to Beige |
| BRN | 1897287 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. Corrosive - causes burns. |
| InChI | InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28) |
| InChIKey | UZUFPBIDKMEQEQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 375-95-1(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorononanoic acid (375-95-1) |
Description and Uses
Perfluorinated compounds (PFCs) are persistent in environments due to the high energy of C-F bond routes. PFNA may interfere in a toxic fashion on the immune system, liver, development, and endocrine systems.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P201-P260-P263-P301+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Hazardous Substances Data | 375-95-1(Hazardous Substances Data) |
