T9219730
(+)-2,3-O-Isopropylidene-L-threitol , >97.0%(GC) , 50622-09-8
Synonym(s):
(+)-2,3-O-Isopropylidene-L -threitol;(4S,5S)-4,5-Bis(hydroxymethyl)-2,2-dimethyl-1,3-dioxolane
CAS NO.:50622-09-8
Empirical Formula: C7H14O4
Molecular Weight: 162.18
MDL number: MFCD00063761
EINECS: 256-658-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB452.00 | In Stock |
|
| 5g | RMB1116.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-50 °C |
| alpha | 3.1 º (c=5, EtOH 24 ºC) |
| Boiling point: | 92-94 °C0.1 mm Hg(lit.) |
| Density | 1.0585 (rough estimate) |
| refractive index | 3.9 ° (C=5, Acetone) |
| Flash point: | >110°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DCM, Ether |
| pka | 13.90±0.10(Predicted) |
| form | Oil |
| color | Clear Colourless |
| optical activity | [α]20/D +3.0±0.5°, c = 5% in ethanol |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 1280797 |
| InChI | 1S/C7H14O4/c1-7(2)10-5(3-8)6(4-9)11-7/h5-6,8-9H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | INVRLGIKFANLFP-WDSKDSINSA-N |
| SMILES | CC1(C)O[C@@H](CO)[C@H](CO)O1 |
| CAS DataBase Reference | 50622-09-8(CAS DataBase Reference) |
Description and Uses
(+)-2,3-O-Isopropylidene-L-threitol is an important raw material and intermediate used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dyestuff.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P310-P330-P332+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29329970 |
| Storage Class | 11 - Combustible Solids |






