PRODUCT Properties
| Melting point: | 343-345°C |
| Density | 1.66 g/cm3 |
| solubility | DMSO : Ethylene Glycol = 2:1 (Slightly) |
| form | powder to crystal |
| Colour Index | 15585 |
| color | Orange to Red |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
| Stability: | Light Sensitive |
| InChI | InChI=1S/2C17H13ClN2O4S.Ba/c2*1-10-8-14(16(9-13(10)18)25(22,23)24)19-20-17-12-5-3-2-4-11(12)6-7-15(17)21;/h2*2-9,21H,1H3,(H,22,23,24);/q;;+2/p-2/b2*20-19+; |
| InChIKey | POJOORKDYOPQLS-FFRZOONGSA-L |
| SMILES | C12C=CC=CC1=CC=C(O)C=2/N=N/C1C=C(C)C(Cl)=CC=1S([O-])(=O)=O.C12C=CC=CC1=CC=C(O)C=2/N=N/C1C=C(C(Cl)=CC=1S([O-])(=O)=O)C.[Ba+2] |
| CAS DataBase Reference | 5160-02-1(CAS DataBase Reference) |
| IARC | 3 (Vol. Sup 7, 57) 1993 |
| EPA Substance Registry System | C.I. Pigment Red 53, barium salt (2:1) (5160-02-1) |
Description and Uses
Lake red CBA is a synthetic organic dye used in pigments for textiles, paints and printing.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H373 |
| Precautionary statements | P260-P264-P270-P301+P310+P330-P314-P405-P501 |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36/37/39 |
| RIDADR | 1564 |
| RTECS | DB5500000 |
| HS Code | 2927.00.5000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Hazardous Substances Data | 5160-02-1(Hazardous Substances Data) |
