T9341330
2-Methyl-1-heptene , >98.0%(GC) , 15870-10-7
CAS NO.:15870-10-7
Empirical Formula: C8H16
Molecular Weight: 112.21
MDL number: MFCD00009517
EINECS: 239-993-2
| Pack Size | Price | Stock | Quantity |
| 5mL | RMB1348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -87.38°C |
| Boiling point: | 117-120 °C (lit.) |
| Density | 0.713 g/mL at 25 °C (lit.) |
| vapor pressure | 38 mm Hg ( 37.7 °C) |
| refractive index | n |
| Flash point: | 50 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1733419 |
| InChI | InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h2,4-7H2,1,3H3 |
| InChIKey | RCBGGJURENJHKV-UHFFFAOYSA-N |
| SMILES | C=C(C)CCCCC |
| LogP | 4.520 (est) |
| CAS DataBase Reference | 15870-10-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Heptene, 2-methyl- (15870-10-7) |
Description and Uses
2-Methyl-1-heptene was used to study the epoxidation of olefins with H2O2; where ionic liquid ( e.g. 1-butyl-3-methylimidazolium hexafluorophosphate) was an activator and Keggin polyoxometalate [bmim]3PW12O40 was the catalyst.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H304 |
| Precautionary statements | P210-P233-P240-P241-P301+P310-P331 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn |
| Risk Statements | 11-65 |
| Safety Statements | 9-16-23-29-33-62 |
| RIDADR | UN 3295 3/PG 2 |
| WGK Germany | 3 |
| HS Code | 2901.29.1050 |
| HazardClass | 3.1 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Asp. Tox. 1 Flam. Liq. 2 |







