T9352430
4-Methoxybenzyl Chloride (stabilized with Amylene) , >98.0%(GC)(T) , 824-94-2
Synonym(s):
4-(Chloromethyl)anisole
CAS NO.:824-94-2
Empirical Formula: C8H9ClO
Molecular Weight: 156.61
MDL number: MFCD00000915
EINECS: 212-540-6
| Pack Size | Price | Stock | Quantity |
| 25mL | RMB556.00 | In Stock |
|
| 100mL | RMB1216.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −1 °C(lit.) |
| Boiling point: | 117-118 °C14 mm Hg(lit.) |
| Density | 1.155 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 229 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | slowly decomposes |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C8H9ClO/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| InChIKey | MOHYOXXOKFQHDC-UHFFFAOYSA-N |
| SMILES | C1(CCl)=CC=C(OC)C=C1 |
| CAS DataBase Reference | 824-94-2(CAS DataBase Reference) |
| NIST Chemistry Reference | «alpha»-Chloro-4-methoxytoluene(824-94-2) |
Description and Uses
4-Methoxybenzylchloride is used in a synthesis of diarymethanes via Suzuki cross-coupling with postassium aryltrifluoroborates. It is also an O/N protecting group reagent which can be mildly oxidatively cleaved, e.g., with ceric ammonium nitrate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Autoignition Temperature | 109℃ |
| Hazard Note | Corrosive |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29093090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |




