T9362730
2-(4-Methoxyphenyl)ethylamine , >98.0%(GC)(T) , 55-81-2
Synonym(s):
2-(4-Methoxyphenyl)ethylamine;4-Methoxyphenethylamine
CAS NO.：55-81-2
Empirical Formula: C9H13NO
Molecular Weight: 151.21
MDL number: MFCD00008192
EINECS: 200-245-5
| Pack Size | Price | Stock | Quantity |
| 25mL | RMB596.00 | In Stock |
|
| 250mL | RMB2776.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 249-251°C |
| Boiling point: | 138-140 °C20 mm Hg(lit.) |
| Density | 1.031 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | liquid |
| pka | 9.96±0.10(Predicted) |
| color | light yellow |
| BRN | 508967 |
| InChI | InChI=1S/C9H13NO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-7,10H2,1H3 |
| InChIKey | LTPVSOCPYWDIFU-UHFFFAOYSA-N |
| SMILES | C1(CCN)=CC=C(OC)C=C1 |
| CAS DataBase Reference | 55-81-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneethanamine, 4-methoxy-(55-81-2) |
| EPA Substance Registry System | Benzeneethanamine, 4-methoxy- (55-81-2) |
Description and Uses
4-Methoxyphenethylamine an inhibitor of the deamination of tyramine and tryptamine. It is intermediates of ritodrine. ritodrine is an adrenergic β2 receptor agonists used to prevent premature birth.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C,T |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| RTECS | SH7875000 |
| F | 10-23 |
| Hazard Note | Toxic/Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29222900 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
