T9366430
(-)-Menthyl Chloride , >98.0%(GC) , 16052-42-9
Synonym(s):
(1R)-(−)-Menthyl chloride;(1S,2R,4R)-2-Chloro-1-isopropyl-1-methylcyclohexane;[1S-(1α,2β,4β)]-2-Chloro-4-methyl-1-(methylethyl)cyclohexane
CAS NO.:16052-42-9
Empirical Formula: C10H19Cl
Molecular Weight: 174.71
MDL number: MFCD00001481
EINECS: 240-200-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB680.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −20-−16.5 °C(lit.) |
| Boiling point: | 101-101.5 °C21 mm Hg(lit.) |
| Density | 0.936 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 174 °F |
| storage temp. | Store at room temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| optical activity | [α]20/D 52.4°, neat |
| BRN | 1902297 |
| InChI | 1S/C10H19Cl/c1-7(2)9-5-4-8(3)6-10(9)11/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | OMLOJNNKKPNVKN-KXUCPTDWSA-N |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1Cl |
| LogP | 4.890 (est) |
Description and Uses
2-Chloro-4-methyl-1-(1-methylethyl)-Cyclohexane is a useful building block for organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H227 |
| Precautionary statements | P501-P210-P280-P370+P378-P403+P235 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 10 - Combustible liquids |






