PRODUCT Properties
| Melting point: | 165°C |
| Density | 1.0183 (rough estimate) |
| refractive index | 1.5618 (estimate) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | almost transparency |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C6H16NO.ClH/c1-6(8)5-7(2,3)4;/h6,8H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RUUHDEGJEGHQKL-UHFFFAOYSA-M |
| SMILES | [N+](C)(C)(C)CC(O)C.[Cl-] |
| EPA Substance Registry System | 1-Propanaminium, 2-hydroxy-N,N,N-trimethyl-, chloride (2382-43-6) |
Description and Uses
β-Methylcholine Chloride is a chitosan quaternized derivative that is used to prepare and study its applicability in anion exchange membrane fuel cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| RTECS | BR5220000 |
| TSCA | TSCA listed |
| HS Code | 2923.90.0100 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LDLo,subcutaneous,630mg/kg (630mg/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 1, Pg. 303, 1909. |




![[(3-allyloxy-2-hydroxy)propyl]trimethylammonium chloride](https://img.chemicalbook.com/CAS/GIF/69613-89-4.gif)


