PRODUCT Properties
| Melting point: | 91-93 °C(lit.) |
| Boiling point: | 466.99°C (rough estimate) |
| Density | 0.8887 (rough estimate) |
| refractive index | 1.4772 (estimate) |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble50mg/mL, clear, colorless |
| form | Liquid |
| pka | 4.78±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1801616 |
| InChI | InChI=1S/C28H56O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h2-27H2,1H3,(H,29,30) |
| InChIKey | UTOPWMOLSKOLTQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCCCCCCCCCCCCCCCCCCCC |
| CAS DataBase Reference | 506-48-9(CAS DataBase Reference) |
| EPA Substance Registry System | Octacosanoic acid (506-48-9) |
Description and Uses
Octacosanoic Acid (cas# 506-48-9) is a useful lubricant compound for preparing flame-retardant and antibacterial sound-insulating tape.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | - |
| HS Code | 2915.90.1800 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







