PRODUCT Properties
| Melting point: | 106.0 to 110.0 °C |
| Boiling point: | 177°C/1.5mmHg(lit.) |
| Density | 1.126±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 17.78±0.30(Predicted) |
| color | White to Light yellow to Dark green |
| InChI | InChI=1S/C11H14N2/c1-8-9(6-7-12)10-4-2-3-5-11(10)13-8/h2-5,13H,6-7,12H2,1H3 |
| InChIKey | CPVSLHQIPGTMLH-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(CCN)=C1C |
| CAS DataBase Reference | 2731-06-8(CAS DataBase Reference) |
Description and Uses
Key starting material in the synthesis of the histone deacetylase inhibitor LBH589.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| HS Code | 2933.99.8290 |
| HazardClass | IRRITANT |
