T9532130
Methyl-PEG12-Azide , >98.0%(HPLC) , 2170098-29-8
CAS NO.:2170098-29-8
Empirical Formula: C25H51N3O12
Molecular Weight: 585.69
MDL number: MFCD13184959
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C25H51N3O12/c1-29-4-5-31-8-9-33-12-13-35-16-17-37-20-21-39-24-25-40-23-22-38-19-18-36-15-14-34-11-10-32-7-6-30-3-2-27-28-26/h2-25H2,1H3 |
| InChIKey | FXVJBKLBTILMNA-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN=[N+]=[N-])OCCOCCOCCOCCOCCOCCOC |
Description and Uses
m-PEG12-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. m-PEG12-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| HS Code | 2929.90.5090 |







