T9551830
2-Nitrobiphenyl , >98.0%(GC) , 86-00-0
CAS NO.：86-00-0
Empirical Formula: C12H9NO2
Molecular Weight: 199.21
MDL number: MFCD00007126
EINECS: 201-646-8
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-38 °C(lit.) |
| Boiling point: | 320 °C |
| Density | 1.44 |
| vapor density | 5.9 (vs air) |
| vapor pressure | 2 mm Hg ( 140 °C) |
| refractive index | 1.613-1.615 |
| Flash point: | >230 °F |
| form | powder to lump |
| color | White to Yellow to Green |
| Water Solubility | Insoluble |
| Merck | 14,6591 |
| InChI | InChI=1S/C12H9NO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey | YOJKKXRJMXIKSR-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 86-00-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1'-Biphenyl, 2-nitro-(86-00-0) |
| EPA Substance Registry System | o-Nitrobiphenyl (86-00-0) |
Description and Uses
2-Nitrobiphenyl is used as a plasticizer for resins, cellulose acetate, cellulose nitrate, and polystyrenes; as a fungicide for textiles; as a wood preservative; and as a dye intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40-68-22 |
| Safety Statements | 2-7-36-45-36/37 |
| WGK Germany | 3 |
| RTECS | DV5530000 |
| HS Code | 2904.20.5000 |
