T9657630
Palmitic Anhydride , >96.0%(GC)(T) , 623-65-4
Synonym(s):
Hexadecanoic anhydride
CAS NO.:623-65-4
Empirical Formula: C32H62O3
Molecular Weight: 494.83
MDL number: MFCD00008992
EINECS: 210-805-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB776.00 | In Stock |
|
| 500g | RMB5800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64 °C (lit.) |
| Boiling point: | 547.77°C (rough estimate) |
| Density | 0.8388 |
| refractive index | 1.4364 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | almost transparency in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1807507 |
| InChI | InChI=1S/C32H62O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31(33)35-32(34)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-30H2,1-2H3 |
| InChIKey | QWZBEFCPZJWDKC-UHFFFAOYSA-N |
| SMILES | C(=O)(CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC |
| LogP | 14.107 (est) |
| CAS DataBase Reference | 623-65-4(CAS DataBase Reference) |
| EPA Substance Registry System | Palmitic acid anhydride (623-65-4) |
Description and Uses
Palmitic anhydride was used in the synthesis of water-soluble N-palmitoyl chitosan (PLCS) by coupling with swollen chitosan in dimethyl sulfoxide (DMSO). It was also used in the synthesis of N-acylphosphatidylserine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





