T9657630
                    Palmitic Anhydride , >96.0%(GC)(T) , 623-65-4
                            Synonym(s):
Hexadecanoic anhydride
                            
                        
                CAS NO.:623-65-4
Empirical Formula: C32H62O3
Molecular Weight: 494.83
MDL number: MFCD00008992
EINECS: 210-805-0
| Pack Size | Price | Stock | Quantity | 
| 25g | RMB776.00 | In Stock | 
                                                 | 
                                        
| 500g | RMB5800.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 61-64 °C (lit.) | 
                                    
| Boiling point: | 547.77°C (rough estimate) | 
                                    
| Density | 0.8388 | 
                                    
| refractive index | 1.4364 (estimate) | 
                                    
| storage temp. | Inert atmosphere,Room Temperature | 
                                    
| solubility | almost transparency in Toluene | 
                                    
| form | powder to crystal | 
                                    
| color | White to Almost white | 
                                    
| BRN | 1807507 | 
                                    
| InChI | InChI=1S/C32H62O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31(33)35-32(34)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-30H2,1-2H3 | 
                                    
| InChIKey | QWZBEFCPZJWDKC-UHFFFAOYSA-N | 
                                    
| SMILES | C(=O)(CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC | 
                                    
| LogP | 14.107 (est) | 
                                    
| CAS DataBase Reference | 623-65-4(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | Palmitic acid anhydride (623-65-4) | 
                                    
Description and Uses
Palmitic anhydride was used in the synthesis of water-soluble N-palmitoyl chitosan (PLCS) by coupling with swollen chitosan in dimethyl sulfoxide (DMSO). It was also used in the synthesis of N-acylphosphatidylserine.
Safety
| Symbol(GHS) | ![]() GHS05  | 
                                    
| Signal word | Danger | 
| Hazard statements | H290-H314 | 
| Precautionary statements | P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P280-P305+P351+P338-P310 | 
| Hazard Codes | C | 
| Risk Statements | 34 | 
| Safety Statements | 26-36/37/39-45-25 | 
| RIDADR | UN 3261 8/PG 2 | 
| WGK Germany | 3 | 
| F | 10-21 | 
| HazardClass | 8 | 
| PackingGroup | III | 
| HS Code | 29159000 | 
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | 
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | 





