PRODUCT Properties
| Melting point: | >250°C |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere |
| solubility | Solubility Soluble in water, ethanol |
| pka | 9.1(at 25℃) |
| form | Powder |
| color | Dark purple to dark brown |
| PH Range | Colorless (8.0) to pink (10.0) |
| λmax | 553nm |
| Stability: | Hygroscopic, Light Sensitive |
| Major Application | Inks, fire-resistant polymers, permanent hair straightener |
| InChI | InChI=1S/C7H16O9S3/c1-17(8,9)14-5-4-7(16-19(3,12)13)6-15-18(2,10)11/h7H,4-6H2,1-3H3 |
| InChIKey | HAWFSFZXNWBZRU-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].[O-]c1ccc(cc1)C(=C3C=CC(=O)C=C3)c2c(cccc2)C(=O)[O-] |
| EPA Substance Registry System | 1(3H)-Isobenzofuranone, 3,3-bis(4-hydroxyphenyl)-, disodium salt (518-51-4) |
Description and Uses
Phenolphthalein (disodium), 95% is a pH indicator.
Safety
| Symbol(GHS) |   GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P271-P261-P264-P304-P340-P312-P302-P352-P362-2-P363-P332-P313-P305-P351-P338-P337-P405-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 29322985 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Muta. 2 Repr. 2 Skin Irrit. 2 |
